| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB00458 |
| Drug Name | Imipramine |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | antagonist |
| PubMed IDs | 7855217 |
| Citations | Cusack B, Nelson A, Richelson E: Binding of antidepressants to human brain receptors: focus on newer generation compounds. Psychopharmacology (Berl). 1994 May;114(4):559-65. |
| Groups | Approved |
| Direct Classification | Dibenzazepines |
| SMILES | CN(C)CCCN1C2=CC=CC=C2CCC2=CC=CC=C12 |
| Pathways | Imipramine Metabolism Pathway; Imipramine Action Pathway |
| PharmGKB | PA449969 |
| ChEMBL | CHEMBL11 |