| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB08936 |
| Drug Name | Chlorcyclizine |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | antagonist |
| PubMed IDs | 21058326 |
| Citations | Enright BP, Gu YZ, Snyder RD, Dugyala RR, Obert LA, Treinen KA, McIntyre BS, Veneziale RW: Effects of the histamine H1 antagonist chlorcyclizine on rat fetal palate development. Birth Defects Res B Dev Reprod Toxicol. 2010 Dec;89(6):474-84. doi: 10.1002/bdrb.20261. |
| Groups | Approved |
| Direct Classification | Diphenylmethanes |
| SMILES | CN1CCN(CC1)C(C1=CC=CC=C1)C1=CC=C(Cl)C=C1 |
| Pathways | Chlorcyclizine H1-Antihistamine Action |
| PharmGKB | |
| ChEMBL | CHEMBL22150 |
