| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB01615 |
| Drug Name | Aceprometazine |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | antagonist |
| PubMed IDs | 17139284; 17016423; 4406367; 11752352 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34.@@Mercier J, Dessaigne S, Menguy A, Manez J: Electro-encephalographic study on the action of the combination meprobamate-aceprometazine on various cerebral systems. Arzneimittelforschung. 1974 Feb;24(2):163-6.@@Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. |
| Groups | Experimental |
| Direct Classification | Phenothiazines |
| SMILES | CC(CN1C2=CC=CC=C2SC2=C1C=C(C=C2)C(C)=O)N(C)C |
| Pathways | |
| PharmGKB | PA164743727 |
| ChEMBL | CHEMBL2104054 |
