| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB00715 |
| Drug Name | Paroxetine |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | inhibitor |
| PubMed IDs | 16620364 |
| Citations | Westenberg HG, Sandner C: Tolerability and safety of fluvoxamine and other antidepressants. Int J Clin Pract. 2006 Apr;60(4):482-91. doi: 10.1111/j.1368-5031.2006.00865.x. |
| Groups | Approved; Investigational |
| Direct Classification | Phenylpiperidines |
| SMILES | FC1=CC=C(C=C1)[C@@H]1CCNC[C@H]1COC1=CC2=C(OCO2)C=C1 |
| Pathways | |
| PharmGKB | PA450801 |
| ChEMBL | CHEMBL490 |
