| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB00985 |
| Drug Name | Dimenhydrinate |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | antagonist |
| PubMed IDs | 11752352; 11835984 |
| Citations | Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5.@@Halpert AG, Olmstead MC, Beninger RJ: Mechanisms and abuse liability of the anti-histamine dimenhydrinate. Neurosci Biobehav Rev. 2002 Jan;26(1):61-7. |
| Groups | Approved |
| Direct Classification | |
| SMILES | CN1C2=C(N=C(Cl)N2)C(=O)N(C)C1=O.CN(C)CCOC(C1=CC=CC=C1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA449338 |
| ChEMBL | CHEMBL1200406 |
