| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB13581 |
| Drug Name | Rociverine |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | antagonist |
| PubMed IDs | 8575526 |
| Citations | Barbier P, Renzetti AR, Turbanti L, Di Bugno C, Fornai F, Vaglini F, Maggio R, Corsini GU: Stereoselective inhibition of muscarinic receptor subtypes by the eight stereoisomers related to rociverine. Eur J Pharmacol. 1995 Jul 18;290(2):125-32. |
| Groups | Experimental |
| Direct Classification | Cyclohexanols |
| SMILES | CCN(CC)CC(C)OC(=O)[C@H]1CCCC[C@]1(O)C1CCCCC1 |
| Pathways | |
| PharmGKB | |
| ChEMBL |
