| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB00342 |
| Drug Name | Terfenadine |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | binder |
| PubMed IDs | 10212017 |
| Citations | Yasuda SU, Yasuda RP: Affinities of brompheniramine, chlorpheniramine, and terfenadine at the five human muscarinic cholinergic receptor subtypes. Pharmacotherapy. 1999 Apr;19(4):447-51. |
| Groups | Approved; Withdrawn |
| Direct Classification | Diphenylmethanes |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Pathways | Terfenadine H1-Antihistamine Action |
| PharmGKB | PA451619 |
| ChEMBL | CHEMBL17157 |
