| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB00321 |
| Drug Name | Amitriptyline |
| Target ID | BE0004890 |
| UniProt ID | P08912 |
| Regulation Type | ligand |
| PubMed IDs | 20504448; 3567263; 14603; 7855217 |
| Citations | Goldman P, Scranton T, Messer WS Jr: Interaction of amitriptyline with muscarinic receptor subtypes in the rat brain. Neurochem Int. 1989;14(4):447-54.@@Dilsaver SC, Snider RM, Alessi NE: Amitriptyline supersensitizes a central cholinergic mechanism. Biol Psychiatry. 1987 Apr;22(4):495-507.@@Snyder SH, Yamamura HI: Antidepressants and the muscarinic acetylcholine receptor. Arch Gen Psychiatry. 1977 Feb;34(2):236-9.@@Cusack B, Nelson A, Richelson E: Binding of antidepressants to human brain receptors: focus on newer generation compounds. Psychopharmacology (Berl). 1994 May;114(4):559-65. |
| Groups | Approved |
| Direct Classification | Dibenzocycloheptenes |
| SMILES | CN(C)CCC=C1C2=CC=CC=C2CCC2=CC=CC=C12 |
| Pathways | |
| PharmGKB | PA448385 |
| ChEMBL | CHEMBL629 |
