| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB00622 |
| Drug Name | Nicardipine |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | antagonist |
| PubMed IDs | 2981533 |
| Citations | Thayer SA, Welcome M, Chhabra A, Fairhurst AS: Effects of dihydropyridine calcium channel blocking drugs on rat brain muscarinic and alpha-adrenergic receptors. Biochem Pharmacol. 1985 Jan 15;34(2):175-80. |
| Groups | Approved; Investigational |
| Direct Classification | Dihydropyridinecarboxylic acids and derivatives |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OCCN(C)CC1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA450620 |
| ChEMBL | CHEMBL1484 |
