| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB02010 |
| Drug Name | Staurosporine |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | |
| PubMed IDs | 10860942 |
| Citations | Lazareno S, Popham A, Birdsall NJ: Allosteric interactions of staurosporine and other indolocarbazoles with N-[methyl-(3)H]scopolamine and acetylcholine at muscarinic receptor subtypes: identification of a second allosteric site. Mol Pharmacol. 2000 Jul;58(1):194-207. |
| Groups | Experimental |
| Direct Classification | Indolocarbazoles |
| SMILES | [H][C@]1(C[C@@]2([H])O[C@](C)(N3C4=CC=CC=C4C4=C5CNC(=O)C5=C5C6=CC=CC=C6N2C5=C34)[C@]1([H])OC)NC |
| Pathways | |
| PharmGKB | PA165109623 |
| ChEMBL | CHEMBL388978 |