| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB00572 |
| Drug Name | Atropine |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | antagonist |
| PubMed IDs | 7855217; 22222705; 1323653 |
| Citations | Cusack B, Nelson A, Richelson E: Binding of antidepressants to human brain receptors: focus on newer generation compounds. Psychopharmacology (Berl). 1994 May;114(4):559-65.@@Buels KS, Fryer AD: Muscarinic receptor antagonists: effects on pulmonary function. Handb Exp Pharmacol. 2012;(208):317-41. doi: 10.1007/978-3-642-23274-9_14.@@Wall SJ, Yasuda RP, Li M, Ciesla W, Wolfe BB: Differential regulation of subtypes m1-m5 of muscarinic receptors in forebrain by chronic atropine administration. J Pharmacol Exp Ther. 1992 Aug;262(2):584-8. |
| Groups | Approved; Vet_approved |
| Direct Classification | Tropane alkaloids |
| SMILES | CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA448505 |
| ChEMBL | CHEMBL517712 |
