| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB11156 |
| Drug Name | Pyrantel |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | antagonist |
| PubMed IDs | 11489460 |
| Citations | Rayes D, De Rosa MJ, Spitzmaul G, Bouzat C: The anthelmintic pyrantel acts as a low efficacious agonist and an open-channel blocker of mammalian acetylcholine receptors. Neuropharmacology. 2001 Aug;41(2):238-45. |
| Groups | Approved; Vet_approved |
| Direct Classification | Hydropyrimidines |
| SMILES | [H]C(=C([H])C1=NCCCN1C)C1=CC=CS1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1626223 |
