| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB01221 |
| Drug Name | Ketamine |
| Target ID | BE0004890 |
| UniProt ID | P08912 |
| Regulation Type | binder |
| PubMed IDs | 8835358 |
| Citations | Hustveit O, Maurset A, Oye I: Interaction of the chiral forms of ketamine with opioid, phencyclidine, sigma and muscarinic receptors. Pharmacol Toxicol. 1995 Dec;77(6):355-9. |
| Groups | Approved; Vet_approved |
| Direct Classification | Chlorobenzenes |
| SMILES | CNC1(CCCCC1=O)C1=CC=CC=C1Cl |
| Pathways | |
| PharmGKB | PA450144 |
| ChEMBL | CHEMBL742 |
