| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB01618 |
| Drug Name | Molindone |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | other/unknown |
| PubMed IDs | 1678146 |
| Citations | Neeper R, Richelson E, Nelson A: Neuroleptic binding to muscarinic M2 receptors of normal human heart in vitro and comparison with binding to M1 and dopamine D2 receptors of brain. Neuropharmacology. 1991 May;30(5):527-9. |
| Groups | Approved |
| Direct Classification | Indoles and derivatives |
| SMILES | CCC1=C(C)NC2=C1C(=O)C(CN1CCOCC1)CC2 |
| Pathways | |
| PharmGKB | PA164746756 |
| ChEMBL | CHEMBL460 |
