| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44000004 | HTLV-1 | ENSG00000168539.4 | protein_coding | CHRM1 | No | No | 1128 | P11229 Q53XZ3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRM1 |
|---|---|
| DrugBank ID | DB01233 |
| Drug Name | Metoclopramide |
| Target ID | BE0000092 |
| UniProt ID | P11229 |
| Regulation Type | agonist |
| PubMed IDs | 21278804 |
| Citations | Lee A, Kuo B: Metoclopramide in the treatment of diabetic gastroparesis. Expert Rev Endocrinol Metab. 2010;5(5):653-662. |
| Groups | Approved; Investigational |
| Direct Classification | Aminophenyl ethers |
| SMILES | CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC |
| Pathways | |
| PharmGKB | PA450475 |
| ChEMBL | CHEMBL86 |
